C14H16N2O4S — CID 104571450
ethyl 2-cyano-2-[4-(cyclopropylsulfamoyl)phenyl]acetate (PubChem CID 104571450) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is ethyl 2-cyano-2-[4-(cyclopropylsulfamoyl)phenyl]acetate.
| Compound Name | ethyl 2-cyano-2-[4-(cyclopropylsulfamoyl)phenyl]acetate |
|---|---|
| PubChem CID | 104571450 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | ethyl 2-cyano-2-[4-(cyclopropylsulfamoyl)phenyl]acetate |
| SMILES | CCOC(=O)C(C#N)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-2-20-14(17)13(9-15)10-3-7-12(8-4-10)21(18,19)16-11-5-6-11/h3-4,7-8,11,13,16H,2,5-6H2,1H3 |
| InChIKey | BANNQFDMPHXUHR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |