C18H27NO5S — CID 21094177
ethyl 2-[4-(ethylsulfamoyl)phenyl]-3-(oxan-4-yl)propanoate (PubChem CID 21094177) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is ethyl 2-[4-(ethylsulfamoyl)phenyl]-3-(oxan-4-yl)propanoate.
| Compound Name | ethyl 2-[4-(ethylsulfamoyl)phenyl]-3-(oxan-4-yl)propanoate |
|---|---|
| PubChem CID | 21094177 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl 2-[4-(ethylsulfamoyl)phenyl]-3-(oxan-4-yl)propanoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(CC2CCOCC2)C(=O)OCC)cc1 |
| InChI | InChI=1S/C18H27NO5S/c1-3-19-25(21,22)16-7-5-15(6-8-16)17(18(20)24-4-2)13-14-9-11-23-12-10-14/h5-8,14,17,19H,3-4,9-13H2,1-2H3 |
| InChIKey | WRYXNACJTXUJEA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |