C19H27NO5S — CID 59331597
2-(4-cyclopropylsulfonylphenyl)-N-methoxy-N-methyl-3-(oxan-4-yl)propanamide (PubChem CID 59331597) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-methoxy-N-methyl-3-(oxan-4-yl)propanamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-methoxy-N-methyl-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 59331597 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-methoxy-N-methyl-3-(oxan-4-yl)propanamide |
| SMILES | CON(C)C(=O)C(CC1CCOCC1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-20(24-2)19(21)18(13-14-9-11-25-12-10-14)15-3-5-16(6-4-15)26(22,23)17-7-8-17/h3-6,14,17-18H,7-13H2,1-2H3 |
| InChIKey | VVWJBINUDDXTDJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|