C18H24O5S — CID 21093929
2-(4-cyclobutylsulfonylphenyl)-3-(oxan-4-yl)propanoic acid (PubChem CID 21093929) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-(4-cyclobutylsulfonylphenyl)-3-(oxan-4-yl)propanoic acid.
| Compound Name | 2-(4-cyclobutylsulfonylphenyl)-3-(oxan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 21093929 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-(4-cyclobutylsulfonylphenyl)-3-(oxan-4-yl)propanoic acid |
| SMILES | O=C(O)C(CC1CCOCC1)c1ccc(S(=O)(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C18H24O5S/c19-18(20)17(12-13-8-10-23-11-9-13)14-4-6-16(7-5-14)24(21,22)15-2-1-3-15/h4-7,13,15,17H,1-3,8-12H2,(H,19,20) |
| InChIKey | UAHDKOITUXMTEL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |