C25H35N2O7PS2 — CID 59649354
(2R)-2-(4-cyclopropylsulfonylphenyl)-N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(oxan-4-yl)propanamide (PubChem CID 59649354) has the molecular formula C25H35N2O7PS2 and a molecular weight of 570.67 g/mol. Its IUPAC name is (2R)-2-(4-cyclopropylsulfonylphenyl)-N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(oxan-4-yl)propanamide.
| Compound Name | (2R)-2-(4-cyclopropylsulfonylphenyl)-N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 59649354 |
| Molecular Formula | C25H35N2O7PS2 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (2R)-2-(4-cyclopropylsulfonylphenyl)-N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(oxan-4-yl)propanamide |
| SMILES | CCOP(=O)(Cc1csc(NC(=O)[C@H](CC2CCOCC2)c2ccc(S(=O)(=O)C3CC3)cc2)n1)OCC |
| InChI | InChI=1S/C25H35N2O7PS2/c1-3-33-35(29,34-4-2)16-20-17-36-25(26-20)27-24(28)23(15-18-11-13-32-14-12-18)19-5-7-21(8-6-19)37(30,31)22-9-10-22/h5-8,17-18,22-23H,3-4,9-16H2,1-2H3,(H,26,27,28)/t23-/m1/s1 |
| InChIKey | DVVVSYPPQZTXSN-HSZRJFAPSA-N |
| XLogP | 5.38 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|