C24H35N2O6PS2 — CID 59649373
(2R)-3-cyclopentyl-N-[4-(2-diethoxyphosphorylethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)propanamide (PubChem CID 59649373) has the molecular formula C24H35N2O6PS2 and a molecular weight of 542.66 g/mol. Its IUPAC name is (2R)-3-cyclopentyl-N-[4-(2-diethoxyphosphorylethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)propanamide.
| Compound Name | (2R)-3-cyclopentyl-N-[4-(2-diethoxyphosphorylethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 59649373 |
| Molecular Formula | C24H35N2O6PS2 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (2R)-3-cyclopentyl-N-[4-(2-diethoxyphosphorylethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)propanamide |
| SMILES | CCOP(=O)(CCc1csc(NC(=O)C(CC2CCCC2)c2ccc(S(C)(=O)=O)cc2)n1)OCC |
| InChI | InChI=1S/C24H35N2O6PS2/c1-4-31-33(28,32-5-2)15-14-20-17-34-24(25-20)26-23(27)22(16-18-8-6-7-9-18)19-10-12-21(13-11-19)35(3,29)30/h10-13,17-18,22H,4-9,14-16H2,1-3H3,(H,25,26,27) |
| InChIKey | NPJICLMJVMOTGO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|