C26H37N2O6PS — CID 58265893
(3R)-4-cyclopentyl-1-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one (PubChem CID 58265893) has the molecular formula C26H37N2O6PS and a molecular weight of 536.63 g/mol. Its IUPAC name is (3R)-4-cyclopentyl-1-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one.
| Compound Name | (3R)-4-cyclopentyl-1-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one |
|---|---|
| PubChem CID | 58265893 |
| Molecular Formula | C26H37N2O6PS |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (3R)-4-cyclopentyl-1-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one |
| SMILES | CCOP(=O)(CCc1cnc(CC(=O)C(CC2CCCC2)c2ccc(S(C)(=O)=O)cc2)cn1)OCC |
| InChI | InChI=1S/C26H37N2O6PS/c1-4-33-35(30,34-5-2)15-14-22-18-28-23(19-27-22)17-26(29)25(16-20-8-6-7-9-20)21-10-12-24(13-11-21)36(3,31)32/h10-13,18-20,25H,4-9,14-17H2,1-3H3 |
| InChIKey | CSGHQCAXFMCUEO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|