C26H37N2O6PS — CID 161032181
(3R)-4-cyclopent-3-en-1-yl-1-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one;methane (PubChem CID 161032181) has the molecular formula C26H37N2O6PS and a molecular weight of 536.63 g/mol. Its IUPAC name is (3R)-4-cyclopent-3-en-1-yl-1-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one;methane.
| Compound Name | (3R)-4-cyclopent-3-en-1-yl-1-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one;methane |
|---|---|
| PubChem CID | 161032181 |
| Molecular Formula | C26H37N2O6PS |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (3R)-4-cyclopent-3-en-1-yl-1-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-3-(4-methylsulfonylphenyl)butan-2-one;methane |
| SMILES | C.CCOP(=O)(Cc1cnc(CC(=O)C(CC2CC=CC2)c2ccc(S(C)(=O)=O)cc2)cn1)OCC |
| InChI | InChI=1S/C25H33N2O6PS.CH4/c1-4-32-34(29,33-5-2)18-22-17-26-21(16-27-22)15-25(28)24(14-19-8-6-7-9-19)20-10-12-23(13-11-20)35(3,30)31;/h6-7,10-13,16-17,19,24H,4-5,8-9,14-15,18H2,1-3H3;1H4 |
| InChIKey | TZTMINKUQIYNJP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|