C25H36N3O6PS — CID 143606774
(2R)-4-cyclopentyl-N-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide (PubChem CID 143606774) has the molecular formula C25H36N3O6PS and a molecular weight of 537.62 g/mol. Its IUPAC name is (2R)-4-cyclopentyl-N-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide.
| Compound Name | (2R)-4-cyclopentyl-N-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 143606774 |
| Molecular Formula | C25H36N3O6PS |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | (2R)-4-cyclopentyl-N-[5-(diethoxyphosphorylmethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide |
| SMILES | CCOP(=O)(Cc1cnc(NC(=O)[C@H](CCC2CCCC2)c2ccc(S(C)(=O)=O)cc2)cn1)OCC |
| InChI | InChI=1S/C25H36N3O6PS/c1-4-33-35(30,34-5-2)18-21-16-27-24(17-26-21)28-25(29)23(15-10-19-8-6-7-9-19)20-11-13-22(14-12-20)36(3,31)32/h11-14,16-17,19,23H,4-10,15,18H2,1-3H3,(H,27,28,29)/t23-/m1/s1 |
| InChIKey | VIYUMKQTCHJSGW-HSZRJFAPSA-N |
| XLogP | 5.34 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|