C21H25ClN4O4S — CID 87417750
(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2Z)-2-hydroxyiminoethyl]pyrazin-2-yl]propanamide (PubChem CID 87417750) has the molecular formula C21H25ClN4O4S and a molecular weight of 464.98 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2Z)-2-hydroxyiminoethyl]pyrazin-2-yl]propanamide.
| Compound Name | (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2Z)-2-hydroxyiminoethyl]pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 87417750 |
| Molecular Formula | C21H25ClN4O4S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2Z)-2-hydroxyiminoethyl]pyrazin-2-yl]propanamide |
| SMILES | CS(=O)(=O)c1ccc([C@@H](CC2CCCC2)C(=O)Nc2cnc(C/C=N\O)cn2)cc1Cl |
| InChI | InChI=1S/C21H25ClN4O4S/c1-31(29,30)19-7-6-15(11-18(19)22)17(10-14-4-2-3-5-14)21(27)26-20-13-23-16(12-24-20)8-9-25-28/h6-7,9,11-14,17,28H,2-5,8,10H2,1H3,(H,24,26,27)/b25-9-/t17-/m1/s1 |
| InChIKey | BYBNLXLMEZYNGT-PYMRLGSBSA-N |
| XLogP | 3.84 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|