C21H26N4O4S — CID 87417676
3-cyclopentyl-N-[5-(1-hydroxy-2-iminoethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)propanamide (PubChem CID 87417676) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-cyclopentyl-N-[5-(1-hydroxy-2-iminoethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)propanamide.
| Compound Name | 3-cyclopentyl-N-[5-(1-hydroxy-2-iminoethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 87417676 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-cyclopentyl-N-[5-(1-hydroxy-2-iminoethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)propanamide |
| SMILES | [H]/N=C/C(O)c1cnc(NC(=O)C(CC2CCCC2)c2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C21H26N4O4S/c1-30(28,29)16-8-6-15(7-9-16)17(10-14-4-2-3-5-14)21(27)25-20-13-23-18(12-24-20)19(26)11-22/h6-9,11-14,17,19,22,26H,2-5,10H2,1H3,(H,24,25,27)/b22-11+ |
| InChIKey | PNWWGTSPOQGMJN-SSDVNMTOSA-N |
| XLogP | 2.87 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|