C26H38N3O6PS — CID 143606655
(2R)-4-cyclopentyl-N-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide (PubChem CID 143606655) has the molecular formula C26H38N3O6PS and a molecular weight of 551.65 g/mol. Its IUPAC name is (2R)-4-cyclopentyl-N-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide.
| Compound Name | (2R)-4-cyclopentyl-N-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 143606655 |
| Molecular Formula | C26H38N3O6PS |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | (2R)-4-cyclopentyl-N-[5-(2-diethoxyphosphorylethyl)pyrazin-2-yl]-2-(4-methylsulfonylphenyl)butanamide |
| SMILES | CCOP(=O)(CCc1cnc(NC(=O)[C@H](CCC2CCCC2)c2ccc(S(C)(=O)=O)cc2)cn1)OCC |
| InChI | InChI=1S/C26H38N3O6PS/c1-4-34-36(31,35-5-2)17-16-22-18-28-25(19-27-22)29-26(30)24(15-10-20-8-6-7-9-20)21-11-13-23(14-12-21)37(3,32)33/h11-14,18-20,24H,4-10,15-17H2,1-3H3,(H,28,29,30)/t24-/m1/s1 |
| InChIKey | LFCDYBDGAMDWCP-XMMPIXPASA-N |
| XLogP | 5.38 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|