C15H18O4S — CID 66908618
(2R)-3-cyclopent-3-en-1-yl-2-(4-methylsulfonylphenyl)propanoic acid (PubChem CID 66908618) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is (2R)-3-cyclopent-3-en-1-yl-2-(4-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2R)-3-cyclopent-3-en-1-yl-2-(4-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 66908618 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (2R)-3-cyclopent-3-en-1-yl-2-(4-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1ccc([C@@H](CC2CC=CC2)C(=O)O)cc1 |
| InChI | InChI=1S/C15H18O4S/c1-20(18,19)13-8-6-12(7-9-13)14(15(16)17)10-11-4-2-3-5-11/h2-3,6-9,11,14H,4-5,10H2,1H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | VKUABBDZRAIQPD-CQSZACIVSA-N |
| XLogP | 2.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|