About sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride
sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride (PubChem CID 173032720) has the molecular formula C15H20ClNaO4S
and a molecular weight of 354.83 g/mol. Its IUPAC name is sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride.
Molecular Properties
| Compound Name | sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride |
| PubChem CID | 173032720 |
| Molecular Formula | C15H20ClNaO4S |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride |
| SMILES | CS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)O)cc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C15H19ClO4S.Na.H/c1-21(19,20)14-7-6-11(9-13(14)16)12(15(17)18)8-10-4-2-3-5-10;;/h6-7,9-10,12H,2-5,8H2,1H3,(H,17,18);;/q;+1;-1 |
| InChIKey | NRPCIHYYPSEQLC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride?
The IUPAC name of sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride (CID 173032720) is sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride.
What is the SMILES notation for sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride?
The canonical SMILES for sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride is CS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)O)cc1Cl.[H-].[Na+].
What is the InChIKey of sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride?
The InChIKey is NRPCIHYYPSEQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClO4S.Na.H/c1-21(19,20)14-7-6-11(9-13(14)16)12(15(17)18)8-10-4-2-3-5-10;;/h6-7,9-10,12H,2-5,8H2,1H3,(H,17,18);;/q;+1;-1.
What are the key properties of sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride?
sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride has a molecular weight of 354.83 g/mol, XLogP of 0.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoic acid;hydride is sourced from PubChem (CID 173032720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).