C14H15ClO5S — CID 67191351
(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-(3-oxocyclobutyl)propanoic acid (PubChem CID 67191351) has the molecular formula C14H15ClO5S and a molecular weight of 330.79 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-(3-oxocyclobutyl)propanoic acid.
| Compound Name | (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-(3-oxocyclobutyl)propanoic acid |
|---|---|
| PubChem CID | 67191351 |
| Molecular Formula | C14H15ClO5S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | (2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-(3-oxocyclobutyl)propanoic acid |
| SMILES | CS(=O)(=O)c1ccc([C@@H](CC2CC(=O)C2)C(=O)O)cc1Cl |
| InChI | InChI=1S/C14H15ClO5S/c1-21(19,20)13-3-2-9(7-12(13)15)11(14(17)18)6-8-4-10(16)5-8/h2-3,7-8,11H,4-6H2,1H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | LPRKTXUNZYSYON-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |