C19H25ClO2S — CID 67188777
(2R)-2-(3-chloro-4-cyclopentylsulfanylphenyl)-3-cyclopentylpropanoic acid (PubChem CID 67188777) has the molecular formula C19H25ClO2S and a molecular weight of 352.93 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-cyclopentylsulfanylphenyl)-3-cyclopentylpropanoic acid.
| Compound Name | (2R)-2-(3-chloro-4-cyclopentylsulfanylphenyl)-3-cyclopentylpropanoic acid |
|---|---|
| PubChem CID | 67188777 |
| Molecular Formula | C19H25ClO2S |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (2R)-2-(3-chloro-4-cyclopentylsulfanylphenyl)-3-cyclopentylpropanoic acid |
| SMILES | O=C(O)[C@H](CC1CCCC1)c1ccc(SC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H25ClO2S/c20-17-12-14(9-10-18(17)23-15-7-3-4-8-15)16(19(21)22)11-13-5-1-2-6-13/h9-10,12-13,15-16H,1-8,11H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | WPCVUHFDXNURLU-MRXNPFEDSA-N |
| XLogP | 6.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |