C17H22Cl2O2 — CID 46221151
methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate (PubChem CID 46221151) has the molecular formula C17H22Cl2O2 and a molecular weight of 329.27 g/mol. Its IUPAC name is methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate.
| Compound Name | methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate |
|---|---|
| PubChem CID | 46221151 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate |
| SMILES | COC(=O)C(CC1CCCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H22Cl2O2/c1-21-17(20)14(10-12-6-4-2-3-5-7-12)13-8-9-15(18)16(19)11-13/h8-9,11-12,14H,2-7,10H2,1H3 |
| InChIKey | HCHWHMPOAUFDOU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |