methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate

C17H22Cl2O2 — CID 46221151

IUPACmethyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate
SMILESCOC(=O)C(CC1CCCCCC1)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C17H22Cl2O2/c1-21-17(20)14(10-12-6-4-2-3-5-7-12)13-8-9-15(18)16(19)11-13/h8-9,11-12,14H,2-7,10H2,1H3
InChIKeyHCHWHMPOAUFDOU-UHFFFAOYSA-N
MW329.27 g/mol
LogP5.61
Rot. Bonds4

About methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate

methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate (PubChem CID 46221151) has the molecular formula C17H22Cl2O2 and a molecular weight of 329.27 g/mol. Its IUPAC name is methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate.

Molecular Properties

Compound Namemethyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate
PubChem CID46221151
Molecular FormulaC17H22Cl2O2
Molecular Weight329.27 g/mol
Exact Mass328.10
IUPAC Namemethyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate
SMILESCOC(=O)C(CC1CCCCCC1)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C17H22Cl2O2/c1-21-17(20)14(10-12-6-4-2-3-5-7-12)13-8-9-15(18)16(19)11-13/h8-9,11-12,14H,2-7,10H2,1H3
InChIKeyHCHWHMPOAUFDOU-UHFFFAOYSA-N
XLogP5.61
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500329.27
LogP ≤ 55.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate?
The IUPAC name of methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate (CID 46221151) is methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate.
What is the SMILES notation for methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate?
The canonical SMILES for methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate is COC(=O)C(CC1CCCCCC1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate?
The InChIKey is HCHWHMPOAUFDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2O2/c1-21-17(20)14(10-12-6-4-2-3-5-7-12)13-8-9-15(18)16(19)11-13/h8-9,11-12,14H,2-7,10H2,1H3.
What are the key properties of methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate?
methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate has a molecular weight of 329.27 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cycloheptyl-2-(3,4-dichlorophenyl)propanoate is sourced from PubChem (CID 46221151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).