C14H18Cl2O — CID 63426977
2-cyclohexyl-1-(3,4-dichlorophenyl)ethanol (PubChem CID 63426977) has the molecular formula C14H18Cl2O and a molecular weight of 273.20 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,4-dichlorophenyl)ethanol.
| Compound Name | 2-cyclohexyl-1-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 63426977 |
| Molecular Formula | C14H18Cl2O |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-cyclohexyl-1-(3,4-dichlorophenyl)ethanol |
| SMILES | OC(CC1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2O/c15-12-7-6-11(9-13(12)16)14(17)8-10-4-2-1-3-5-10/h6-7,9-10,14,17H,1-5,8H2 |
| InChIKey | JBJLMPLVZSLINC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |