C13H17Cl2NO — CID 94591374
(1S)-2-(cyclopentylamino)-1-(3,4-dichlorophenyl)ethanol (PubChem CID 94591374) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is (1S)-2-(cyclopentylamino)-1-(3,4-dichlorophenyl)ethanol.
| Compound Name | (1S)-2-(cyclopentylamino)-1-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 94591374 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (1S)-2-(cyclopentylamino)-1-(3,4-dichlorophenyl)ethanol |
| SMILES | O[C@H](CNC1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO/c14-11-6-5-9(7-12(11)15)13(17)8-16-10-3-1-2-4-10/h5-7,10,13,16-17H,1-4,8H2/t13-/m1/s1 |
| InChIKey | IDXZJXYCNPEGIL-CYBMUJFWSA-N |
| XLogP | 3.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |