C15H20ClNO2 — CID 106987579
methyl 2-(2-amino-3-chlorophenyl)-3-cyclopentylpropanoate (PubChem CID 106987579) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is methyl 2-(2-amino-3-chlorophenyl)-3-cyclopentylpropanoate.
| Compound Name | methyl 2-(2-amino-3-chlorophenyl)-3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 106987579 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | methyl 2-(2-amino-3-chlorophenyl)-3-cyclopentylpropanoate |
| SMILES | COC(=O)C(CC1CCCC1)c1cccc(Cl)c1N |
| InChI | InChI=1S/C15H20ClNO2/c1-19-15(18)12(9-10-5-2-3-6-10)11-7-4-8-13(16)14(11)17/h4,7-8,10,12H,2-3,5-6,9,17H2,1H3 |
| InChIKey | MEEVCWXOFGXCFL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|