C15H20ClNO2 — CID 106987780
2-(2-amino-3-chlorophenyl)-3-cyclohexylpropanoic acid (PubChem CID 106987780) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 2-(2-amino-3-chlorophenyl)-3-cyclohexylpropanoic acid.
| Compound Name | 2-(2-amino-3-chlorophenyl)-3-cyclohexylpropanoic acid |
|---|---|
| PubChem CID | 106987780 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(2-amino-3-chlorophenyl)-3-cyclohexylpropanoic acid |
| SMILES | Nc1c(Cl)cccc1C(CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C15H20ClNO2/c16-13-8-4-7-11(14(13)17)12(15(18)19)9-10-5-2-1-3-6-10/h4,7-8,10,12H,1-3,5-6,9,17H2,(H,18,19) |
| InChIKey | MOUXTNUHZPTWFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|