C18H27NO2 — CID 106988076
2-(2-amino-5-tert-butylphenyl)-3-cyclopentylpropanoic acid (PubChem CID 106988076) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(2-amino-5-tert-butylphenyl)-3-cyclopentylpropanoic acid.
| Compound Name | 2-(2-amino-5-tert-butylphenyl)-3-cyclopentylpropanoic acid |
|---|---|
| PubChem CID | 106988076 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-(2-amino-5-tert-butylphenyl)-3-cyclopentylpropanoic acid |
| SMILES | CC(C)(C)c1ccc(N)c(C(CC2CCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C18H27NO2/c1-18(2,3)13-8-9-16(19)14(11-13)15(17(20)21)10-12-6-4-5-7-12/h8-9,11-12,15H,4-7,10,19H2,1-3H3,(H,20,21) |
| InChIKey | CEJBLGNNZRVLBM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|