C17H26O3 — CID 175095952
2-(5-tert-butyl-2-hydroxyphenyl)-4,4-dimethylpentanoic acid (PubChem CID 175095952) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-hydroxyphenyl)-4,4-dimethylpentanoic acid.
| Compound Name | 2-(5-tert-butyl-2-hydroxyphenyl)-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175095952 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-(5-tert-butyl-2-hydroxyphenyl)-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(C(=O)O)c1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C17H26O3/c1-16(2,3)10-13(15(19)20)12-9-11(17(4,5)6)7-8-14(12)18/h7-9,13,18H,10H2,1-6H3,(H,19,20) |
| InChIKey | SSLKUOAYWLQRNI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |