C21H29O2P — CID 23082212
4-tert-butyl-2-[(5-tert-butyl-2-hydroxyphenyl)-phosphanylmethyl]phenol (PubChem CID 23082212) has the molecular formula C21H29O2P and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-tert-butyl-2-[(5-tert-butyl-2-hydroxyphenyl)-phosphanylmethyl]phenol.
| Compound Name | 4-tert-butyl-2-[(5-tert-butyl-2-hydroxyphenyl)-phosphanylmethyl]phenol |
|---|---|
| PubChem CID | 23082212 |
| Molecular Formula | C21H29O2P |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-tert-butyl-2-[(5-tert-butyl-2-hydroxyphenyl)-phosphanylmethyl]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(C(P)c2cc(C(C)(C)C)ccc2O)c1 |
| InChI | InChI=1S/C21H29O2P/c1-20(2,3)13-7-9-17(22)15(11-13)19(24)16-12-14(21(4,5)6)8-10-18(16)23/h7-12,19,22-23H,24H2,1-6H3 |
| InChIKey | UYRIKDIBUFKLMY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|