About 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol
2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 117377747) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| PubChem CID | 117377747 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(N)c1cc(C(C)(C)CC(C)(C)C)ccc1O |
| InChI | InChI=1S/C16H27NO/c1-11(17)13-9-12(7-8-14(13)18)16(5,6)10-15(2,3)4/h7-9,11,18H,10,17H2,1-6H3 |
| InChIKey | AQOZQYNRKDZUOI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol?
The IUPAC name of 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol (CID 117377747) is 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
What is the SMILES notation for 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol?
The canonical SMILES for 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol is CC(N)c1cc(C(C)(C)CC(C)(C)C)ccc1O.
What is the InChIKey of 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol?
The InChIKey is AQOZQYNRKDZUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-11(17)13-9-12(7-8-14(13)18)16(5,6)10-15(2,3)4/h7-9,11,18H,10,17H2,1-6H3.
What are the key properties of 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol?
2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol has a molecular weight of 249.40 g/mol, XLogP of 4.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethyl)-4-(2,4,4-trimethylpentan-2-yl)phenol is sourced from PubChem (CID 117377747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).