About 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol
2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol (PubChem CID 117296793) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol.
Molecular Properties
| Compound Name | 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol |
| PubChem CID | 117296793 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol |
| SMILES | CC(N)c1cc(CC(C)(C)C)ccc1O |
| InChI | InChI=1S/C13H21NO/c1-9(14)11-7-10(5-6-12(11)15)8-13(2,3)4/h5-7,9,15H,8,14H2,1-4H3 |
| InChIKey | OWCGLKDEPLDOLL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol?
The IUPAC name of 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol (CID 117296793) is 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol.
What is the SMILES notation for 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol?
The canonical SMILES for 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol is CC(N)c1cc(CC(C)(C)C)ccc1O.
What is the InChIKey of 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol?
The InChIKey is OWCGLKDEPLDOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-9(14)11-7-10(5-6-12(11)15)8-13(2,3)4/h5-7,9,15H,8,14H2,1-4H3.
What are the key properties of 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol?
2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol has a molecular weight of 207.32 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethyl)-4-(2,2-dimethylpropyl)phenol is sourced from PubChem (CID 117296793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).