About 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol
2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol (PubChem CID 117320726) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol.
Molecular Properties
| Compound Name | 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol |
| PubChem CID | 117320726 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol |
| SMILES | CC(C)(C)Cc1ccc(O)c(C(O)CN)c1 |
| InChI | InChI=1S/C13H21NO2/c1-13(2,3)7-9-4-5-11(15)10(6-9)12(16)8-14/h4-6,12,15-16H,7-8,14H2,1-3H3 |
| InChIKey | OUFNEOLGGKCJBK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol?
The IUPAC name of 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol (CID 117320726) is 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol.
What is the SMILES notation for 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol?
The canonical SMILES for 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol is CC(C)(C)Cc1ccc(O)c(C(O)CN)c1.
What is the InChIKey of 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol?
The InChIKey is OUFNEOLGGKCJBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-13(2,3)7-9-4-5-11(15)10(6-9)12(16)8-14/h4-6,12,15-16H,7-8,14H2,1-3H3.
What are the key properties of 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol?
2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol has a molecular weight of 223.32 g/mol, XLogP of 1.97, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1-hydroxyethyl)-4-(2,2-dimethylpropyl)phenol is sourced from PubChem (CID 117320726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).