C17H29NO — CID 117413896
2-(1-aminopropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 117413896) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2-(1-aminopropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(1-aminopropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 117413896 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-(1-aminopropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(CN)c1cc(C(C)(C)CC(C)(C)C)ccc1O |
| InChI | InChI=1S/C17H29NO/c1-12(10-18)14-9-13(7-8-15(14)19)17(5,6)11-16(2,3)4/h7-9,12,19H,10-11,18H2,1-6H3 |
| InChIKey | WYFJHJQVNGXXBX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |