C16H26O — CID 67779766
4-(2-methylbutan-2-yl)-2-pentan-2-ylphenol (PubChem CID 67779766) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-pentan-2-ylphenol.
| Compound Name | 4-(2-methylbutan-2-yl)-2-pentan-2-ylphenol |
|---|---|
| PubChem CID | 67779766 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-pentan-2-ylphenol |
| SMILES | CCCC(C)c1cc(C(C)(C)CC)ccc1O |
| InChI | InChI=1S/C16H26O/c1-6-8-12(3)14-11-13(9-10-15(14)17)16(4,5)7-2/h9-12,17H,6-8H2,1-5H3 |
| InChIKey | HWHBXMOFLDKYNN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |