C42H64O3S2 — CID 159638292
2-[[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]disulfanyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 159638292) has the molecular formula C42H64O3S2 and a molecular weight of 681.11 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]disulfanyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-[[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]disulfanyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 159638292 |
| Molecular Formula | C42H64O3S2 |
| Molecular Weight | 681.11 g/mol |
| Exact Mass | 680.43 |
| IUPAC Name | 2-[[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]disulfanyl]-4-(2,4,4-trimethylpentan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(SSc2cc(C(C)(C)CC(C)(C)C)ccc2O)c1.CC(C)(C)CC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C28H42O2S2.C14H22O/c1-25(2,3)17-27(7,8)19-11-13-21(29)23(15-19)31-32-24-16-20(12-14-22(24)30)28(9,10)18-26(4,5)6;1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h11-16,29-30H,17-18H2,1-10H3;6-9,15H,10H2,1-5H3 |
| InChIKey | MQACROLBSWLQSY-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.11 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|