C44H74O2S — CID 87580532
2-[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]sulfanyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 87580532) has the molecular formula C44H74O2S and a molecular weight of 667.14 g/mol. Its IUPAC name is 2-[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]sulfanyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]sulfanyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 87580532 |
| Molecular Formula | C44H74O2S |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.54 |
| IUPAC Name | 2-[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]sulfanyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Sc2cc(C(C)(C)CC(C)(C)C)cc(C(C)(C)CC(C)(C)C)c2O)c(O)c(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C44H74O2S/c1-37(2,3)25-41(13,14)29-21-31(43(17,18)27-39(7,8)9)35(45)33(23-29)47-34-24-30(42(15,16)26-38(4,5)6)22-32(36(34)46)44(19,20)28-40(10,11)12/h21-24,45-46H,25-28H2,1-20H3 |
| InChIKey | AYUBHWYUAKTBGU-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |