C38H61O2Y- — CID 157282834
2-[[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-methanidyl-4-(2,4,4-trimethylpentan-2-yl)phenol;yttrium (PubChem CID 157282834) has the molecular formula C38H61O2Y- and a molecular weight of 638.81 g/mol. Its IUPAC name is 2-[[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-methanidyl-4-(2,4,4-trimethylpentan-2-yl)phenol;yttrium.
| Compound Name | 2-[[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-methanidyl-4-(2,4,4-trimethylpentan-2-yl)phenol;yttrium |
|---|---|
| PubChem CID | 157282834 |
| Molecular Formula | C38H61O2Y- |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 2-[[2-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-methanidyl-4-(2,4,4-trimethylpentan-2-yl)phenol;yttrium |
| SMILES | [CH2-]c1cc(C(C)(C)CC(C)(C)C)cc(Cc2cc(C(C)(C)CC(C)(C)C)cc(C(C)(C)CC(C)(C)C)c2O)c1O.[Y] |
| InChI | InChI=1S/C38H61O2.Y/c1-25-17-28(36(11,12)22-33(2,3)4)19-26(31(25)39)18-27-20-29(37(13,14)23-34(5,6)7)21-30(32(27)40)38(15,16)24-35(8,9)10;/h17,19-21,39-40H,1,18,22-24H2,2-16H3;/q-1; |
| InChIKey | AXDHELGRPSFMTL-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|