C46H78O2 — CID 22769774
4-[1-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 22769774) has the molecular formula C46H78O2 and a molecular weight of 663.13 g/mol. Its IUPAC name is 4-[1-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 4-[1-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 22769774 |
| Molecular Formula | C46H78O2 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.60 |
| IUPAC Name | 4-[1-[4-hydroxy-3,5-bis(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]-2,6-bis(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(c1cc(C(C)(C)CC(C)(C)C)c(O)c(C(C)(C)CC(C)(C)C)c1)c1cc(C(C)(C)CC(C)(C)C)c(O)c(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C46H78O2/c1-30(31-22-33(43(14,15)26-39(2,3)4)37(47)34(23-31)44(16,17)27-40(5,6)7)32-24-35(45(18,19)28-41(8,9)10)38(48)36(25-32)46(20,21)29-42(11,12)13/h22-25,30,47-48H,26-29H2,1-21H3 |
| InChIKey | IKTSILXIQQZQLD-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |