C15H24O2 — CID 156787448
4-methyl-5-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol (PubChem CID 156787448) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 4-methyl-5-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol.
| Compound Name | 4-methyl-5-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 156787448 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4-methyl-5-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)cc1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H24O2/c1-10-7-12(16)13(17)8-11(10)15(5,6)9-14(2,3)4/h7-8,16-17H,9H2,1-6H3 |
| InChIKey | ONSHLDNMNCIJCR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|