C17H28O2 — CID 22734658
4-(3-hydroxypropyl)-2-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 22734658) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-(3-hydroxypropyl)-2-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 4-(3-hydroxypropyl)-2-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 22734658 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4-(3-hydroxypropyl)-2-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(CCCO)ccc1O |
| InChI | InChI=1S/C17H28O2/c1-16(2,3)12-17(4,5)14-11-13(7-6-10-18)8-9-15(14)19/h8-9,11,18-19H,6-7,10,12H2,1-5H3 |
| InChIKey | MWBZEVZYERPVKI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |