C16H26O5 — CID 174372134
4-(3-tert-butyl-4-hydroxyphenyl)butanoic acid;ethane-1,2-diol (PubChem CID 174372134) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-(3-tert-butyl-4-hydroxyphenyl)butanoic acid;ethane-1,2-diol.
| Compound Name | 4-(3-tert-butyl-4-hydroxyphenyl)butanoic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 174372134 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-(3-tert-butyl-4-hydroxyphenyl)butanoic acid;ethane-1,2-diol |
| SMILES | CC(C)(C)c1cc(CCCC(=O)O)ccc1O.OCCO |
| InChI | InChI=1S/C14H20O3.C2H6O2/c1-14(2,3)11-9-10(7-8-12(11)15)5-4-6-13(16)17;3-1-2-4/h7-9,15H,4-6H2,1-3H3,(H,16,17);3-4H,1-2H2 |
| InChIKey | CVCBCRALPLODJH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |