C59H96O14S — CID 173394022
2,2-bis(hydroxymethyl)propane-1,3-diol;tris(3-(3-tert-butyl-4-hydroxyphenyl)propanoic acid);pentadecanethioic S-acid (PubChem CID 173394022) has the molecular formula C59H96O14S and a molecular weight of 1061.47 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;tris(3-(3-tert-butyl-4-hydroxyphenyl)propanoic acid);pentadecanethioic S-acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;tris(3-(3-tert-butyl-4-hydroxyphenyl)propanoic acid);pentadecanethioic S-acid |
|---|---|
| PubChem CID | 173394022 |
| Molecular Formula | C59H96O14S |
| Molecular Weight | 1061.47 g/mol |
| Exact Mass | 1060.65 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;tris(3-(3-tert-butyl-4-hydroxyphenyl)propanoic acid);pentadecanethioic S-acid |
| SMILES | CC(C)(C)c1cc(CCC(=O)O)ccc1O.CC(C)(C)c1cc(CCC(=O)O)ccc1O.CC(C)(C)c1cc(CCC(=O)O)ccc1O.CCCCCCCCCCCCCCC(=O)S.OCC(CO)(CO)CO |
| InChI | InChI=1S/C15H30OS.3C13H18O3.C5H12O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;3*1-13(2,3)10-8-9(4-6-11(10)14)5-7-12(15)16;6-1-5(2-7,3-8)4-9/h2-14H2,1H3,(H,16,17);3*4,6,8,14H,5,7H2,1-3H3,(H,15,16);6-9H,1-4H2 |
| InChIKey | NIKWLFOYJCNEGU-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 270.58 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.47 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|