C19H42O9S — CID 121377184
bis(2,2-bis(hydroxymethyl)propane-1,3-diol);nonanethioic S-acid (PubChem CID 121377184) has the molecular formula C19H42O9S and a molecular weight of 446.60 g/mol. Its IUPAC name is bis(2,2-bis(hydroxymethyl)propane-1,3-diol);nonanethioic S-acid.
| Compound Name | bis(2,2-bis(hydroxymethyl)propane-1,3-diol);nonanethioic S-acid |
|---|---|
| PubChem CID | 121377184 |
| Molecular Formula | C19H42O9S |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | bis(2,2-bis(hydroxymethyl)propane-1,3-diol);nonanethioic S-acid |
| SMILES | CCCCCCCCC(=O)S.OCC(CO)(CO)CO.OCC(CO)(CO)CO |
| InChI | InChI=1S/C9H18OS.2C5H12O4/c1-2-3-4-5-6-7-8-9(10)11;2*6-1-5(2-7,3-8)4-9/h2-8H2,1H3,(H,10,11);2*6-9H,1-4H2 |
| InChIKey | AQOYTIRAGHVGBM-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|