C23H51NO6 — CID 172688556
azane;2,2-bis(hydroxymethyl)propane-1,3-diol;octadecanoic acid (PubChem CID 172688556) has the molecular formula C23H51NO6 and a molecular weight of 437.66 g/mol. Its IUPAC name is azane;2,2-bis(hydroxymethyl)propane-1,3-diol;octadecanoic acid.
| Compound Name | azane;2,2-bis(hydroxymethyl)propane-1,3-diol;octadecanoic acid |
|---|---|
| PubChem CID | 172688556 |
| Molecular Formula | C23H51NO6 |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.37 |
| IUPAC Name | azane;2,2-bis(hydroxymethyl)propane-1,3-diol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.N.OCC(CO)(CO)CO |
| InChI | InChI=1S/C18H36O2.C5H12O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-1-5(2-7,3-8)4-9;/h2-17H2,1H3,(H,19,20);6-9H,1-4H2;1H3 |
| InChIKey | BJBQEVQASWRMTR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|