C35H68O14 — CID 160622558
2,2-bis(hydroxymethyl)propane-1,3-diol;bis(hexanedioic acid);octadecanoic acid (PubChem CID 160622558) has the molecular formula C35H68O14 and a molecular weight of 712.91 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;bis(hexanedioic acid);octadecanoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;bis(hexanedioic acid);octadecanoic acid |
|---|---|
| PubChem CID | 160622558 |
| Molecular Formula | C35H68O14 |
| Molecular Weight | 712.91 g/mol |
| Exact Mass | 712.46 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;bis(hexanedioic acid);octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.O=C(O)CCCCC(=O)O.O=C(O)CCCCC(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C18H36O2.2C6H10O4.C5H12O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*7-5(8)3-1-2-4-6(9)10;6-1-5(2-7,3-8)4-9/h2-17H2,1H3,(H,19,20);2*1-4H2,(H,7,8)(H,9,10);6-9H,1-4H2 |
| InChIKey | RGWRUWKILQNTBM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 267.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.91 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|