C23H46O6 — CID 6436385
2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-octadec-9-enoic acid (PubChem CID 6436385) has the molecular formula C23H46O6 and a molecular weight of 418.62 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-octadec-9-enoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 6436385 |
| Molecular Formula | C23H46O6 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C18H34O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-1-5(2-7,3-8)4-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-9H,1-4H2/b10-9-; |
| InChIKey | ARWLNYJOVMFZNY-KVVVOXFISA-N |
| XLogP | 4.05 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|