C27H54O4 — CID 173033224
2-butyl-2-ethylpropane-1,3-diol;octadec-9-enoic acid (PubChem CID 173033224) has the molecular formula C27H54O4 and a molecular weight of 442.73 g/mol. Its IUPAC name is 2-butyl-2-ethylpropane-1,3-diol;octadec-9-enoic acid.
| Compound Name | 2-butyl-2-ethylpropane-1,3-diol;octadec-9-enoic acid |
|---|---|
| PubChem CID | 173033224 |
| Molecular Formula | C27H54O4 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.40 |
| IUPAC Name | 2-butyl-2-ethylpropane-1,3-diol;octadec-9-enoic acid |
| SMILES | CCCCC(CC)(CO)CO.CCCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C9H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-6-9(4-2,7-10)8-11/h9-10H,2-8,11-17H2,1H3,(H,19,20);10-11H,3-8H2,1-2H3 |
| InChIKey | NMXHUNYTOCZZTE-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|