C14H30O5 — CID 18692882
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;octanoic acid (PubChem CID 18692882) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;octanoic acid.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;octanoic acid |
|---|---|
| PubChem CID | 18692882 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;octanoic acid |
| SMILES | CCC(CO)(CO)CO.CCCCCCCC(=O)O |
| InChI | InChI=1S/C8H16O2.C6H14O3/c1-2-3-4-5-6-7-8(9)10;1-2-6(3-7,4-8)5-9/h2-7H2,1H3,(H,9,10);7-9H,2-5H2,1H3 |
| InChIKey | CWTQBXKJKDAOSQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|