2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid

C11H24O6 — CID 87271774

IUPAC2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid
SMILESCCCCCC(=O)O.OCC(CO)(CO)CO
InChIInChI=1S/C6H12O2.C5H12O4/c1-2-3-4-5-6(7)8;6-1-5(2-7,3-8)4-9/h2-5H2,1H3,(H,7,8);6-9H,1-4H2
InChIKeyBDBZNOLQRHDUOQ-UHFFFAOYSA-N
MW252.31 g/mol
LogP-0.41
Rot. Bonds8

About 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid

2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid (PubChem CID 87271774) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid.

Molecular Properties

Compound Name2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid
PubChem CID87271774
Molecular FormulaC11H24O6
Molecular Weight252.31 g/mol
Exact Mass252.16
IUPAC Name2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid
SMILESCCCCCC(=O)O.OCC(CO)(CO)CO
InChIInChI=1S/C6H12O2.C5H12O4/c1-2-3-4-5-6(7)8;6-1-5(2-7,3-8)4-9/h2-5H2,1H3,(H,7,8);6-9H,1-4H2
InChIKeyBDBZNOLQRHDUOQ-UHFFFAOYSA-N
XLogP-0.41
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 5-0.41
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid?
The IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid (CID 87271774) is 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid.
What is the SMILES notation for 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid?
The canonical SMILES for 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid is CCCCCC(=O)O.OCC(CO)(CO)CO.
What is the InChIKey of 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid?
The InChIKey is BDBZNOLQRHDUOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C5H12O4/c1-2-3-4-5-6(7)8;6-1-5(2-7,3-8)4-9/h2-5H2,1H3,(H,7,8);6-9H,1-4H2.
What are the key properties of 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid?
2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid has a molecular weight of 252.31 g/mol, XLogP of -0.41, 8 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid is sourced from PubChem (CID 87271774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).