C11H24O6 — CID 87271774
2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid (PubChem CID 87271774) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid |
|---|---|
| PubChem CID | 87271774 |
| Molecular Formula | C11H24O6 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;hexanoic acid |
| SMILES | CCCCCC(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C6H12O2.C5H12O4/c1-2-3-4-5-6(7)8;6-1-5(2-7,3-8)4-9/h2-5H2,1H3,(H,7,8);6-9H,1-4H2 |
| InChIKey | BDBZNOLQRHDUOQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|