C18H38O7 — CID 87402381
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;heptanoic acid;pentanoic acid (PubChem CID 87402381) has the molecular formula C18H38O7 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;heptanoic acid;pentanoic acid.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;heptanoic acid;pentanoic acid |
|---|---|
| PubChem CID | 87402381 |
| Molecular Formula | C18H38O7 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;heptanoic acid;pentanoic acid |
| SMILES | CCC(CO)(CO)CO.CCCCC(=O)O.CCCCCCC(=O)O |
| InChI | InChI=1S/C7H14O2.C6H14O3.C5H10O2/c1-2-3-4-5-6-7(8)9;1-2-6(3-7,4-8)5-9;1-2-3-4-5(6)7/h2-6H2,1H3,(H,8,9);7-9H,2-5H2,1H3;2-4H2,1H3,(H,6,7) |
| InChIKey | BHWBBAYOMXQXQH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|