C49H106O17S — CID 173452305
tetrakis(2,2-dimethylpropane-1,1-diol);bis(3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid);nonadecanethioic S-acid (PubChem CID 173452305) has the molecular formula C49H106O17S and a molecular weight of 999.44 g/mol. Its IUPAC name is tetrakis(2,2-dimethylpropane-1,1-diol);bis(3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid);nonadecanethioic S-acid.
| Compound Name | tetrakis(2,2-dimethylpropane-1,1-diol);bis(3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid);nonadecanethioic S-acid |
|---|---|
| PubChem CID | 173452305 |
| Molecular Formula | C49H106O17S |
| Molecular Weight | 999.44 g/mol |
| Exact Mass | 998.72 |
| IUPAC Name | tetrakis(2,2-dimethylpropane-1,1-diol);bis(3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid);nonadecanethioic S-acid |
| SMILES | CC(C)(C)C(O)O.CC(C)(C)C(O)O.CC(C)(C)C(O)O.CC(C)(C)C(O)O.CC(CO)(CO)C(=O)O.CC(CO)(CO)C(=O)O.CCCCCCCCCCCCCCCCCCC(=O)S |
| InChI | InChI=1S/C19H38OS.2C5H10O4.4C5H12O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;2*1-5(2-6,3-7)4(8)9;4*1-5(2,3)4(6)7/h2-18H2,1H3,(H,20,21);2*6-7H,2-3H2,1H3,(H,8,9);4*4,6-7H,1-3H3 |
| InChIKey | LCYCFQGAJPUBKV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 334.43 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.44 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|