C16H26O — CID 154203171
4,5-dimethyl-2-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 154203171) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 4,5-dimethyl-2-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 154203171 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 4,5-dimethyl-2-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | Cc1cc(O)c(C(C)(C)CC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H26O/c1-11-8-13(14(17)9-12(11)2)16(6,7)10-15(3,4)5/h8-9,17H,10H2,1-7H3 |
| InChIKey | SIYQTQMBHFAWBZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |