C32H42O4 — CID 59638972
2,5-bis[4-(4-hydroxy-3,5-dimethylphenyl)-2-methylbutan-2-yl]benzene-1,4-diol (PubChem CID 59638972) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is 2,5-bis[4-(4-hydroxy-3,5-dimethylphenyl)-2-methylbutan-2-yl]benzene-1,4-diol.
| Compound Name | 2,5-bis[4-(4-hydroxy-3,5-dimethylphenyl)-2-methylbutan-2-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 59638972 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 2,5-bis[4-(4-hydroxy-3,5-dimethylphenyl)-2-methylbutan-2-yl]benzene-1,4-diol |
| SMILES | Cc1cc(CCC(C)(C)c2cc(O)c(C(C)(C)CCc3cc(C)c(O)c(C)c3)cc2O)cc(C)c1O |
| InChI | InChI=1S/C32H42O4/c1-19-13-23(14-20(2)29(19)35)9-11-31(5,6)25-17-28(34)26(18-27(25)33)32(7,8)12-10-24-15-21(3)30(36)22(4)16-24/h13-18,33-36H,9-12H2,1-8H3 |
| InChIKey | RCAHWGBPVOGWQE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|