C35H40O3 — CID 58676222
4-[3,5-bis(4-hydroxy-3,5-dimethylphenyl)-3-phenylpentyl]-2,6-dimethylphenol (PubChem CID 58676222) has the molecular formula C35H40O3 and a molecular weight of 508.70 g/mol. Its IUPAC name is 4-[3,5-bis(4-hydroxy-3,5-dimethylphenyl)-3-phenylpentyl]-2,6-dimethylphenol.
| Compound Name | 4-[3,5-bis(4-hydroxy-3,5-dimethylphenyl)-3-phenylpentyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 58676222 |
| Molecular Formula | C35H40O3 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 4-[3,5-bis(4-hydroxy-3,5-dimethylphenyl)-3-phenylpentyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(CCC(CCc2cc(C)c(O)c(C)c2)(c2ccccc2)c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C35H40O3/c1-22-16-28(17-23(2)32(22)36)12-14-35(30-10-8-7-9-11-30,31-20-26(5)34(38)27(6)21-31)15-13-29-18-24(3)33(37)25(4)19-29/h7-11,16-21,36-38H,12-15H2,1-6H3 |
| InChIKey | RPARJPGOFJMZCQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |