C24H23F3O2 — CID 20520008
2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-hydroxy-3,5-dimethylphenyl)-1-phenylethyl]phenol (PubChem CID 20520008) has the molecular formula C24H23F3O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-hydroxy-3,5-dimethylphenyl)-1-phenylethyl]phenol.
| Compound Name | 2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-hydroxy-3,5-dimethylphenyl)-1-phenylethyl]phenol |
|---|---|
| PubChem CID | 20520008 |
| Molecular Formula | C24H23F3O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2,6-dimethyl-4-[2,2,2-trifluoro-1-(4-hydroxy-3,5-dimethylphenyl)-1-phenylethyl]phenol |
| SMILES | Cc1cc(C(c2ccccc2)(c2cc(C)c(O)c(C)c2)C(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C24H23F3O2/c1-14-10-19(11-15(2)21(14)28)23(24(25,26)27,18-8-6-5-7-9-18)20-12-16(3)22(29)17(4)13-20/h5-13,28-29H,1-4H3 |
| InChIKey | BOOSLOPWNRWEIQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|